C29H45N3O6 — CID 163151908
[3-acetyloxy-1-[4-hydroxy-3-methoxy-5-[[6-(methylaminomethylamino)-1,2-dihydropyridin-4-yl]methyl]phenyl]decan-5-yl] acetate (PubChem CID 163151908) has the molecular formula C29H45N3O6 and a molecular weight of 531.69 g/mol. Its IUPAC name is [3-acetyloxy-1-[4-hydroxy-3-methoxy-5-[[6-(methylaminomethylamino)-1,2-dihydropyridin-4-yl]methyl]phenyl]decan-5-yl] acetate.
| Compound Name | [3-acetyloxy-1-[4-hydroxy-3-methoxy-5-[[6-(methylaminomethylamino)-1,2-dihydropyridin-4-yl]methyl]phenyl]decan-5-yl] acetate |
|---|---|
| PubChem CID | 163151908 |
| Molecular Formula | C29H45N3O6 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | [3-acetyloxy-1-[4-hydroxy-3-methoxy-5-[[6-(methylaminomethylamino)-1,2-dihydropyridin-4-yl]methyl]phenyl]decan-5-yl] acetate |
| SMILES | CCCCCC(CC(CCc1cc(CC2=CCNC(NCNC)=C2)c(O)c(OC)c1)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C29H45N3O6/c1-6-7-8-9-25(37-20(2)33)18-26(38-21(3)34)11-10-22-14-24(29(35)27(16-22)36-5)15-23-12-13-31-28(17-23)32-19-30-4/h12,14,16-17,25-26,30-32,35H,6-11,13,15,18-19H2,1-5H3 |
| InChIKey | NQQWQNTYGJWTEG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|