C34H46N2O6 — CID 163161452
[(3R,5S)-3-acetyloxy-1-[3-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-4-hydroxy-5-methoxyphenyl]-11-phenylundecan-5-yl] acetate (PubChem CID 163161452) has the molecular formula C34H46N2O6 and a molecular weight of 578.75 g/mol. Its IUPAC name is [(3R,5S)-3-acetyloxy-1-[3-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-4-hydroxy-5-methoxyphenyl]-11-phenylundecan-5-yl] acetate.
| Compound Name | [(3R,5S)-3-acetyloxy-1-[3-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-4-hydroxy-5-methoxyphenyl]-11-phenylundecan-5-yl] acetate |
|---|---|
| PubChem CID | 163161452 |
| Molecular Formula | C34H46N2O6 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | [(3R,5S)-3-acetyloxy-1-[3-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-4-hydroxy-5-methoxyphenyl]-11-phenylundecan-5-yl] acetate |
| SMILES | COc1cc(CC[C@H](C[C@H](CCCCCCc2ccccc2)OC(C)=O)OC(C)=O)cc(CC2=CCNC(N)=C2)c1O |
| InChI | InChI=1S/C34H46N2O6/c1-24(37)41-30(14-10-5-4-7-11-26-12-8-6-9-13-26)23-31(42-25(2)38)16-15-27-19-29(34(39)32(21-27)40-3)20-28-17-18-36-33(35)22-28/h6,8-9,12-13,17,19,21-22,30-31,36,39H,4-5,7,10-11,14-16,18,20,23,35H2,1-3H3/t30-,31+/m0/s1 |
| InChIKey | RDXHCDJTMPUMHJ-IOWSJCHKSA-N |
| XLogP | 5.65 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|