C36H51NO6 — CID 163054103
[1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5-hydroxy-12-phenyldodecan-3-yl] acetate (PubChem CID 163054103) has the molecular formula C36H51NO6 and a molecular weight of 593.81 g/mol. Its IUPAC name is [1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5-hydroxy-12-phenyldodecan-3-yl] acetate.
| Compound Name | [1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5-hydroxy-12-phenyldodecan-3-yl] acetate |
|---|---|
| PubChem CID | 163054103 |
| Molecular Formula | C36H51NO6 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.37 |
| IUPAC Name | [1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5-hydroxy-12-phenyldodecan-3-yl] acetate |
| SMILES | CC(=O)OC(CCc1cc(CN2CCCC2=O)c(O)c(OC2CCCC2)c1)CC(O)CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C36H51NO6/c1-27(38)42-33(25-31(39)16-9-4-2-3-6-13-28-14-7-5-8-15-28)21-20-29-23-30(26-37-22-12-19-35(37)40)36(41)34(24-29)43-32-17-10-11-18-32/h5,7-8,14-15,23-24,31-33,39,41H,2-4,6,9-13,16-22,25-26H2,1H3 |
| InChIKey | KXOOWQNSBQAQIP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|