C26H44N2O6 — CID 162900037
[(3R,5S)-5-hydroxy-1-(4-hydroxy-3-piperidin-4-yloxyphenyl)-10-[[(2S)-2-hydroxypropyl]amino]decan-3-yl] acetate (PubChem CID 162900037) has the molecular formula C26H44N2O6 and a molecular weight of 480.65 g/mol. Its IUPAC name is [(3R,5S)-5-hydroxy-1-(4-hydroxy-3-piperidin-4-yloxyphenyl)-10-[[(2S)-2-hydroxypropyl]amino]decan-3-yl] acetate.
| Compound Name | [(3R,5S)-5-hydroxy-1-(4-hydroxy-3-piperidin-4-yloxyphenyl)-10-[[(2S)-2-hydroxypropyl]amino]decan-3-yl] acetate |
|---|---|
| PubChem CID | 162900037 |
| Molecular Formula | C26H44N2O6 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | [(3R,5S)-5-hydroxy-1-(4-hydroxy-3-piperidin-4-yloxyphenyl)-10-[[(2S)-2-hydroxypropyl]amino]decan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](CCc1ccc(O)c(OC2CCNCC2)c1)C[C@@H](O)CCCCCNC[C@H](C)O |
| InChI | InChI=1S/C26H44N2O6/c1-19(29)18-28-13-5-3-4-6-22(31)17-24(33-20(2)30)9-7-21-8-10-25(32)26(16-21)34-23-11-14-27-15-12-23/h8,10,16,19,22-24,27-29,31-32H,3-7,9,11-15,17-18H2,1-2H3/t19-,22-,24+/m0/s1 |
| InChIKey | SMLNWPORSUWYSR-NGYIFUPDSA-N |
| XLogP | 2.67 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|