C31H53N5O6 — CID 162825867
[(1R,3R)-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)-1-[(1R,3R,4R)-4-[[[(2S)-2-hydroxypropyl]amino]methyl]-3-[[(N'-methylcarbamimidoyl)amino]methyl]cyclohexyl]pentan-3-yl] acetate (PubChem CID 162825867) has the molecular formula C31H53N5O6 and a molecular weight of 591.79 g/mol. Its IUPAC name is [(1R,3R)-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)-1-[(1R,3R,4R)-4-[[[(2S)-2-hydroxypropyl]amino]methyl]-3-[[(N'-methylcarbamimidoyl)amino]methyl]cyclohexyl]pentan-3-yl] acetate.
| Compound Name | [(1R,3R)-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)-1-[(1R,3R,4R)-4-[[[(2S)-2-hydroxypropyl]amino]methyl]-3-[[(N'-methylcarbamimidoyl)amino]methyl]cyclohexyl]pentan-3-yl] acetate |
|---|---|
| PubChem CID | 162825867 |
| Molecular Formula | C31H53N5O6 |
| Molecular Weight | 591.79 g/mol |
| Exact Mass | 591.40 |
| IUPAC Name | [(1R,3R)-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)-1-[(1R,3R,4R)-4-[[[(2S)-2-hydroxypropyl]amino]methyl]-3-[[(N'-methylcarbamimidoyl)amino]methyl]cyclohexyl]pentan-3-yl] acetate |
| SMILES | C/N=C(\N)NC[C@@H]1C[C@H]([C@H](O)C[C@@H](CCc2ccc(O)c(OC3CCNCC3)c2)OC(C)=O)CC[C@H]1CNC[C@H](C)O |
| InChI | InChI=1S/C31H53N5O6/c1-20(37)17-35-18-24-7-6-23(15-25(24)19-36-31(32)33-3)29(40)16-27(41-21(2)38)8-4-22-5-9-28(39)30(14-22)42-26-10-12-34-13-11-26/h5,9,14,20,23-27,29,34-35,37,39-40H,4,6-8,10-13,15-19H2,1-3H3,(H3,32,33,36)/t20-,23+,24-,25-,27+,29+/m0/s1 |
| InChIKey | KVNSFYMXNIZNCT-ZKCKPKDWSA-N |
| XLogP | 1.68 |
| TPSA | 170.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|