C23H36O5 — CID 162936966
[(3R,5S)-1-(3-cyclopentyloxy-4-hydroxyphenyl)-5-hydroxydecan-3-yl] acetate (PubChem CID 162936966) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is [(3R,5S)-1-(3-cyclopentyloxy-4-hydroxyphenyl)-5-hydroxydecan-3-yl] acetate.
| Compound Name | [(3R,5S)-1-(3-cyclopentyloxy-4-hydroxyphenyl)-5-hydroxydecan-3-yl] acetate |
|---|---|
| PubChem CID | 162936966 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [(3R,5S)-1-(3-cyclopentyloxy-4-hydroxyphenyl)-5-hydroxydecan-3-yl] acetate |
| SMILES | CCCCC[C@H](O)C[C@@H](CCc1ccc(O)c(OC2CCCC2)c1)OC(C)=O |
| InChI | InChI=1S/C23H36O5/c1-3-4-5-8-19(25)16-21(27-17(2)24)13-11-18-12-14-22(26)23(15-18)28-20-9-6-7-10-20/h12,14-15,19-21,25-26H,3-11,13,16H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | MMXYMRDNQQZEMH-PZJWPPBQSA-N |
| XLogP | 4.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|