C25H38O6 — CID 162826113
[(3R,5S)-3-acetyloxy-1-(3-cyclopentyloxy-4-hydroxyphenyl)decan-5-yl] acetate (PubChem CID 162826113) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is [(3R,5S)-3-acetyloxy-1-(3-cyclopentyloxy-4-hydroxyphenyl)decan-5-yl] acetate.
| Compound Name | [(3R,5S)-3-acetyloxy-1-(3-cyclopentyloxy-4-hydroxyphenyl)decan-5-yl] acetate |
|---|---|
| PubChem CID | 162826113 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [(3R,5S)-3-acetyloxy-1-(3-cyclopentyloxy-4-hydroxyphenyl)decan-5-yl] acetate |
| SMILES | CCCCC[C@@H](C[C@@H](CCc1ccc(O)c(OC2CCCC2)c1)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H38O6/c1-4-5-6-11-22(29-18(2)26)17-23(30-19(3)27)14-12-20-13-15-24(28)25(16-20)31-21-9-7-8-10-21/h13,15-16,21-23,28H,4-12,14,17H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | RRASSSYPNJIGQN-XZOQPEGZSA-N |
| XLogP | 5.48 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|