C29H46O6 — CID 162994100
[(1R,3R)-1-acetyloxy-1-cyclooctyl-5-(4-hydroxy-3-methoxy-5-pentylphenyl)pentan-3-yl] acetate (PubChem CID 162994100) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is [(1R,3R)-1-acetyloxy-1-cyclooctyl-5-(4-hydroxy-3-methoxy-5-pentylphenyl)pentan-3-yl] acetate.
| Compound Name | [(1R,3R)-1-acetyloxy-1-cyclooctyl-5-(4-hydroxy-3-methoxy-5-pentylphenyl)pentan-3-yl] acetate |
|---|---|
| PubChem CID | 162994100 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | [(1R,3R)-1-acetyloxy-1-cyclooctyl-5-(4-hydroxy-3-methoxy-5-pentylphenyl)pentan-3-yl] acetate |
| SMILES | CCCCCc1cc(CC[C@H](C[C@@H](OC(C)=O)C2CCCCCCC2)OC(C)=O)cc(OC)c1O |
| InChI | InChI=1S/C29H46O6/c1-5-6-10-15-25-18-23(19-28(33-4)29(25)32)16-17-26(34-21(2)30)20-27(35-22(3)31)24-13-11-8-7-9-12-14-24/h18-19,24,26-27,32H,5-17,20H2,1-4H3/t26-,27-/m1/s1 |
| InChIKey | MBFUERCVBYFXAP-KAYWLYCHSA-N |
| XLogP | 6.68 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|