C29H47NO6 — CID 162825983
[5-hydroxy-1-[4-hydroxy-3-methoxy-5-[(2-oxo-5-pentylpyrrolidin-1-yl)methyl]phenyl]decan-3-yl] acetate (PubChem CID 162825983) has the molecular formula C29H47NO6 and a molecular weight of 505.70 g/mol. Its IUPAC name is [5-hydroxy-1-[4-hydroxy-3-methoxy-5-[(2-oxo-5-pentylpyrrolidin-1-yl)methyl]phenyl]decan-3-yl] acetate.
| Compound Name | [5-hydroxy-1-[4-hydroxy-3-methoxy-5-[(2-oxo-5-pentylpyrrolidin-1-yl)methyl]phenyl]decan-3-yl] acetate |
|---|---|
| PubChem CID | 162825983 |
| Molecular Formula | C29H47NO6 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | [5-hydroxy-1-[4-hydroxy-3-methoxy-5-[(2-oxo-5-pentylpyrrolidin-1-yl)methyl]phenyl]decan-3-yl] acetate |
| SMILES | CCCCCC(O)CC(CCc1cc(CN2C(=O)CCC2CCCCC)c(O)c(OC)c1)OC(C)=O |
| InChI | InChI=1S/C29H47NO6/c1-5-7-9-11-24-14-16-28(33)30(24)20-23-17-22(18-27(35-4)29(23)34)13-15-26(36-21(3)31)19-25(32)12-10-8-6-2/h17-18,24-26,32,34H,5-16,19-20H2,1-4H3 |
| InChIKey | HOBUONUUGJYHIE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|