C31H49NO7 — CID 163047992
[(3R,5S)-1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5,13-dihydroxytridecan-3-yl] acetate (PubChem CID 163047992) has the molecular formula C31H49NO7 and a molecular weight of 547.73 g/mol. Its IUPAC name is [(3R,5S)-1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5,13-dihydroxytridecan-3-yl] acetate.
| Compound Name | [(3R,5S)-1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5,13-dihydroxytridecan-3-yl] acetate |
|---|---|
| PubChem CID | 163047992 |
| Molecular Formula | C31H49NO7 |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | [(3R,5S)-1-[3-cyclopentyloxy-4-hydroxy-5-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-5,13-dihydroxytridecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](CCc1cc(CN2CCCC2=O)c(O)c(OC2CCCC2)c1)C[C@@H](O)CCCCCCCCO |
| InChI | InChI=1S/C31H49NO7/c1-23(34)38-28(21-26(35)11-6-4-2-3-5-9-18-33)16-15-24-19-25(22-32-17-10-14-30(32)36)31(37)29(20-24)39-27-12-7-8-13-27/h19-20,26-28,33,35,37H,2-18,21-22H2,1H3/t26-,28+/m0/s1 |
| InChIKey | OFJOCQFXVQCVAJ-XTEPFMGCSA-N |
| XLogP | 5.17 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|