C40H60N6O5 — CID 163102724
[7-(6-amino-3,5,7,12-tetrazatricyclo[10.3.1.13,14]heptadec-5-en-9-yl)-1-[3-(2-benzylpiperidin-4-yl)oxy-4-hydroxyphenyl]-5-hydroxyheptan-3-yl] acetate (PubChem CID 163102724) has the molecular formula C40H60N6O5 and a molecular weight of 704.96 g/mol. Its IUPAC name is [7-(6-amino-3,5,7,12-tetrazatricyclo[10.3.1.13,14]heptadec-5-en-9-yl)-1-[3-(2-benzylpiperidin-4-yl)oxy-4-hydroxyphenyl]-5-hydroxyheptan-3-yl] acetate.
| Compound Name | [7-(6-amino-3,5,7,12-tetrazatricyclo[10.3.1.13,14]heptadec-5-en-9-yl)-1-[3-(2-benzylpiperidin-4-yl)oxy-4-hydroxyphenyl]-5-hydroxyheptan-3-yl] acetate |
|---|---|
| PubChem CID | 163102724 |
| Molecular Formula | C40H60N6O5 |
| Molecular Weight | 704.96 g/mol |
| Exact Mass | 704.46 |
| IUPAC Name | [7-(6-amino-3,5,7,12-tetrazatricyclo[10.3.1.13,14]heptadec-5-en-9-yl)-1-[3-(2-benzylpiperidin-4-yl)oxy-4-hydroxyphenyl]-5-hydroxyheptan-3-yl] acetate |
| SMILES | CC(=O)OC(CCc1ccc(O)c(OC2CCNC(Cc3ccccc3)C2)c1)CC(O)CCC1CCN2CC3CC(C2)CN(CN=C(N)NC1)C3 |
| InChI | InChI=1S/C40H60N6O5/c1-28(47)50-36(11-8-30-9-12-38(49)39(19-30)51-37-13-15-42-34(20-37)18-29-5-3-2-4-6-29)21-35(48)10-7-31-14-16-45-23-32-17-33(24-45)26-46(25-32)27-44-40(41)43-22-31/h2-6,9,12,19,31-37,42,48-49H,7-8,10-11,13-18,20-27H2,1H3,(H3,41,43,44) |
| InChIKey | PWBCVCUEYBQONQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |