C40H48N2O7 — CID 162825875
(5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[(2R,4R)-2-benzylpiperidin-4-yl]oxy-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one (PubChem CID 162825875) has the molecular formula C40H48N2O7 and a molecular weight of 668.83 g/mol. Its IUPAC name is (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[(2R,4R)-2-benzylpiperidin-4-yl]oxy-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one.
| Compound Name | (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[(2R,4R)-2-benzylpiperidin-4-yl]oxy-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one |
|---|---|
| PubChem CID | 162825875 |
| Molecular Formula | C40H48N2O7 |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[(2R,4R)-2-benzylpiperidin-4-yl]oxy-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one |
| SMILES | NCOc1cc(CCC(=O)C[C@H](O)C[C@H](CCc2ccccc2)c2cc(O)c(O)c(O[C@@H]3CCN[C@H](Cc4ccccc4)C3)c2)ccc1O |
| InChI | InChI=1S/C40H48N2O7/c41-26-48-38-20-29(13-16-36(38)45)12-15-33(43)25-34(44)21-30(14-11-27-7-3-1-4-8-27)31-22-37(46)40(47)39(23-31)49-35-17-18-42-32(24-35)19-28-9-5-2-6-10-28/h1-10,13,16,20,22-23,30,32,34-35,42,44-47H,11-12,14-15,17-19,21,24-26,41H2/t30-,32+,34+,35+/m0/s1 |
| InChIKey | ZDGULSIYSGGBMD-ZHADSICRSA-N |
| XLogP | 5.90 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|