C37H48N2O7 — CID 162983944
(5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(10S)-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one (PubChem CID 162983944) has the molecular formula C37H48N2O7 and a molecular weight of 632.80 g/mol. Its IUPAC name is (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(10S)-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one.
| Compound Name | (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(10S)-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one |
|---|---|
| PubChem CID | 162983944 |
| Molecular Formula | C37H48N2O7 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(10S)-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one |
| SMILES | NCOc1cc(CCC(=O)C[C@H](O)C[C@H](CCc2ccccc2)c2cc(O)c(O)c(O[C@H]3CCNCC34CCCC4)c2)ccc1O |
| InChI | InChI=1S/C37H48N2O7/c38-24-45-33-18-26(10-13-31(33)42)9-12-29(40)22-30(41)19-27(11-8-25-6-2-1-3-7-25)28-20-32(43)36(44)34(21-28)46-35-14-17-39-23-37(35)15-4-5-16-37/h1-3,6-7,10,13,18,20-21,27,30,35,39,41-44H,4-5,8-9,11-12,14-17,19,22-24,38H2/t27-,30+,35-/m0/s1 |
| InChIKey | OHBRWRLFPZUTLS-OYEMMXNXSA-N |
| XLogP | 5.46 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|