C35H42O6 — CID 162832531
(2R,6R)-1-[(4aS,10aR)-7,8-dihydroxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-yl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one (PubChem CID 162832531) has the molecular formula C35H42O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is (2R,6R)-1-[(4aS,10aR)-7,8-dihydroxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-yl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one.
| Compound Name | (2R,6R)-1-[(4aS,10aR)-7,8-dihydroxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-yl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one |
|---|---|
| PubChem CID | 162832531 |
| Molecular Formula | C35H42O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | (2R,6R)-1-[(4aS,10aR)-7,8-dihydroxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-4a-yl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one |
| SMILES | COc1cc(C(CCc2ccccc2)CC(=O)C[C@H](O)C[C@@]23CCCC[C@@H]2CCc2c3ccc(O)c2O)ccc1O |
| InChI | InChI=1S/C35H42O6/c1-41-33-20-25(12-16-31(33)38)24(11-10-23-7-3-2-4-8-23)19-27(36)21-28(37)22-35-18-6-5-9-26(35)13-14-29-30(35)15-17-32(39)34(29)40/h2-4,7-8,12,15-17,20,24,26,28,37-40H,5-6,9-11,13-14,18-19,21-22H2,1H3/t24?,26-,28+,35+/m1/s1 |
| InChIKey | KEGJBMJPAVLXFC-COEAKQMTSA-N |
| XLogP | 6.70 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|