C31H36O7 — CID 162840697
(5R)-6-[(1S,2S)-2-benzyl-6,7-dihydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)hexan-3-one (PubChem CID 162840697) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is (5R)-6-[(1S,2S)-2-benzyl-6,7-dihydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)hexan-3-one.
| Compound Name | (5R)-6-[(1S,2S)-2-benzyl-6,7-dihydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)hexan-3-one |
|---|---|
| PubChem CID | 162840697 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (5R)-6-[(1S,2S)-2-benzyl-6,7-dihydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)hexan-3-one |
| SMILES | COc1cc(CCC(=O)C[C@H](O)C[C@@H]2c3cc(O)c(O)c(OC)c3CC[C@H]2Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C31H36O7/c1-37-29-15-20(9-13-27(29)34)8-11-22(32)16-23(33)17-25-21(14-19-6-4-3-5-7-19)10-12-24-26(25)18-28(35)30(36)31(24)38-2/h3-7,9,13,15,18,21,23,25,33-36H,8,10-12,14,16-17H2,1-2H3/t21-,23-,25-/m0/s1 |
| InChIKey | UMDXXUQSRFLUDK-RSEQLOHWSA-N |
| XLogP | 5.05 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|