C22H29NO7 — CID 162837321
(5R)-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-1-[4-hydroxy-3-(methylaminomethoxy)phenyl]heptan-3-one (PubChem CID 162837321) has the molecular formula C22H29NO7 and a molecular weight of 419.47 g/mol. Its IUPAC name is (5R)-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-1-[4-hydroxy-3-(methylaminomethoxy)phenyl]heptan-3-one.
| Compound Name | (5R)-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-1-[4-hydroxy-3-(methylaminomethoxy)phenyl]heptan-3-one |
|---|---|
| PubChem CID | 162837321 |
| Molecular Formula | C22H29NO7 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (5R)-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-1-[4-hydroxy-3-(methylaminomethoxy)phenyl]heptan-3-one |
| SMILES | CNCOc1cc(CCC(=O)C[C@H](O)CCc2cc(O)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H29NO7/c1-23-13-30-20-10-14(5-8-18(20)26)3-6-16(24)12-17(25)7-4-15-9-19(27)22(28)21(11-15)29-2/h5,8-11,17,23,25-28H,3-4,6-7,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | NROYBVVPOXQXNS-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|