C19H22O6 — CID 13347317
1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-one (PubChem CID 13347317) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-one.
| Compound Name | 1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-one |
|---|---|
| PubChem CID | 13347317 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1,7-bis(3,4-dihydroxyphenyl)-5-hydroxyheptan-3-one |
| SMILES | O=C(CCc1ccc(O)c(O)c1)CC(O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H22O6/c20-14(5-1-12-3-7-16(22)18(24)9-12)11-15(21)6-2-13-4-8-17(23)19(25)10-13/h3-4,7-10,14,20,22-25H,1-2,5-6,11H2 |
| InChIKey | MVIYWFBLVAFZID-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|