C27H31NO8 — CID 162984829
(5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxyheptan-3-one (PubChem CID 162984829) has the molecular formula C27H31NO8 and a molecular weight of 497.54 g/mol. Its IUPAC name is (5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxyheptan-3-one.
| Compound Name | (5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxyheptan-3-one |
|---|---|
| PubChem CID | 162984829 |
| Molecular Formula | C27H31NO8 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxyheptan-3-one |
| SMILES | NCOc1cc(CCC(=O)C[C@H](O)CCc2cc(O)c(O)c(OCc3cccc(O)c3)c2)ccc1O |
| InChI | InChI=1S/C27H31NO8/c28-16-36-25-12-17(6-9-23(25)32)4-7-21(30)14-22(31)8-5-18-11-24(33)27(34)26(13-18)35-15-19-2-1-3-20(29)10-19/h1-3,6,9-13,22,29,31-34H,4-5,7-8,14-16,28H2/t22-/m1/s1 |
| InChIKey | FOKQPRBBTHCTKN-JOCHJYFZSA-N |
| XLogP | 3.27 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|