C42H38O10 — CID 172870789
5-[2-[4-hydroxy-3,5-bis[2-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenyl]ethyl]benzene-1,2,3-triol (PubChem CID 172870789) has the molecular formula C42H38O10 and a molecular weight of 702.76 g/mol. Its IUPAC name is 5-[2-[4-hydroxy-3,5-bis[2-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenyl]ethyl]benzene-1,2,3-triol.
| Compound Name | 5-[2-[4-hydroxy-3,5-bis[2-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenyl]ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 172870789 |
| Molecular Formula | C42H38O10 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | 5-[2-[4-hydroxy-3,5-bis[2-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]phenoxy]phenyl]ethyl]benzene-1,2,3-triol |
| SMILES | Oc1cccc(CCc2ccc(O)c(Oc3cc(CCc4cc(O)c(O)c(O)c4)cc(Oc4cc(CCc5cccc(O)c5)ccc4O)c3O)c2)c1 |
| InChI | InChI=1S/C42H38O10/c43-31-5-1-3-25(17-31)7-9-27-13-15-33(45)37(21-27)51-39-23-30(12-11-29-19-35(47)41(49)36(48)20-29)24-40(42(39)50)52-38-22-28(14-16-34(38)46)10-8-26-4-2-6-32(44)18-26/h1-6,13-24,43-50H,7-12H2 |
| InChIKey | UVIYJFVXRQOJHA-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|