C16H20N2O5 — CID 129036058
3-[5-(2-aminoethyl)-2-hydroxyphenoxy]-5-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 129036058) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[5-(2-aminoethyl)-2-hydroxyphenoxy]-5-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 3-[5-(2-aminoethyl)-2-hydroxyphenoxy]-5-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 129036058 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[5-(2-aminoethyl)-2-hydroxyphenoxy]-5-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | NCCc1ccc(O)c(Oc2cc([C@@H](O)CN)cc(O)c2O)c1 |
| InChI | InChI=1S/C16H20N2O5/c17-4-3-9-1-2-11(19)14(5-9)23-15-7-10(13(21)8-18)6-12(20)16(15)22/h1-2,5-7,13,19-22H,3-4,8,17-18H2/t13-/m0/s1 |
| InChIKey | UHILZIYXHXPCPI-ZDUSSCGKSA-N |
| XLogP | 1.09 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|