C10H15NO4 — CID 70003904
4-[(1R)-2-amino-1-hydroxyethyl]-2-(1-hydroxyethoxy)phenol (PubChem CID 70003904) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 4-[(1R)-2-amino-1-hydroxyethyl]-2-(1-hydroxyethoxy)phenol.
| Compound Name | 4-[(1R)-2-amino-1-hydroxyethyl]-2-(1-hydroxyethoxy)phenol |
|---|---|
| PubChem CID | 70003904 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-[(1R)-2-amino-1-hydroxyethyl]-2-(1-hydroxyethoxy)phenol |
| SMILES | CC(O)Oc1cc([C@@H](O)CN)ccc1O |
| InChI | InChI=1S/C10H15NO4/c1-6(12)15-10-4-7(9(14)5-11)2-3-8(10)13/h2-4,6,9,12-14H,5,11H2,1H3/t6?,9-/m0/s1 |
| InChIKey | SLUZBDSIFPAXLI-HSOSERFQSA-N |
| XLogP | 0.10 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|