C17H27NO11 — CID 87096344
[5-(2-amino-1-hydroxyethyl)-2-hydroxyphenyl] 2-hydroxypropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 87096344) has the molecular formula C17H27NO11 and a molecular weight of 421.40 g/mol. Its IUPAC name is [5-(2-amino-1-hydroxyethyl)-2-hydroxyphenyl] 2-hydroxypropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | [5-(2-amino-1-hydroxyethyl)-2-hydroxyphenyl] 2-hydroxypropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 87096344 |
| Molecular Formula | C17H27NO11 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [5-(2-amino-1-hydroxyethyl)-2-hydroxyphenyl] 2-hydroxypropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CC(O)C(=O)Oc1cc(C(O)CN)ccc1O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H15NO5.C6H12O6/c1-6(13)11(16)17-10-4-7(9(15)5-12)2-3-8(10)14;7-1-3(9)5(11)6(12)4(10)2-8/h2-4,6,9,13-15H,5,12H2,1H3;1,3-6,8-12H,2H2/t;3-,4+,5+,6+/m.0/s1 |
| InChIKey | PSYRFRFGHWNALD-SSPAHAAFSA-N |
| XLogP | -3.71 |
| TPSA | 231.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|