C13H18O11 — CID 175950976
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;3,4,5-trihydroxybenzoic acid (PubChem CID 175950976) has the molecular formula C13H18O11 and a molecular weight of 350.28 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;3,4,5-trihydroxybenzoic acid.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 175950976 |
| Molecular Formula | C13H18O11 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;3,4,5-trihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1.O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H6O5.C6H12O6/c8-4-1-3(7(11)12)2-5(9)6(4)10;7-1-3(9)5(11)6(12)4(10)2-8/h1-2,8-10H,(H,11,12);1,3-6,8-12H,2H2/t;3-,4+,5+,6-/m.0/s1 |
| InChIKey | WYJFRQVUQLEMCI-LNEKJHARSA-N |
| XLogP | -2.88 |
| TPSA | 216.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|