C26H32O20 — CID 174603195
2,3,4,5,6-pentahydroxyhexanal;2,3,4,5,6-pentahydroxy-7-oxo-3-(3,4,5-trihydroxybenzoyl)-7-(3,4,5-trihydroxyphenyl)heptanal (PubChem CID 174603195) has the molecular formula C26H32O20 and a molecular weight of 664.52 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;2,3,4,5,6-pentahydroxy-7-oxo-3-(3,4,5-trihydroxybenzoyl)-7-(3,4,5-trihydroxyphenyl)heptanal.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;2,3,4,5,6-pentahydroxy-7-oxo-3-(3,4,5-trihydroxybenzoyl)-7-(3,4,5-trihydroxyphenyl)heptanal |
|---|---|
| PubChem CID | 174603195 |
| Molecular Formula | C26H32O20 |
| Molecular Weight | 664.52 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;2,3,4,5,6-pentahydroxy-7-oxo-3-(3,4,5-trihydroxybenzoyl)-7-(3,4,5-trihydroxyphenyl)heptanal |
| SMILES | O=CC(O)C(O)(C(=O)c1cc(O)c(O)c(O)c1)C(O)C(O)C(O)C(=O)c1cc(O)c(O)c(O)c1.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C20H20O14.C6H12O6/c21-5-12(26)20(34,18(32)7-3-10(24)15(29)11(25)4-7)19(33)17(31)16(30)13(27)6-1-8(22)14(28)9(23)2-6;7-1-3(9)5(11)6(12)4(10)2-8/h1-5,12,16-17,19,22-26,28-31,33-34H;1,3-6,8-12H,2H2 |
| InChIKey | AMFNRKCJRRSSRK-UHFFFAOYSA-N |
| XLogP | -6.02 |
| TPSA | 391.96 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.52 |
| LogP ≤ 5 | -6.02 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|