C13H18O12 — CID 87916459
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;3,4,5-trihydroxybenzoic acid (PubChem CID 87916459) has the molecular formula C13H18O12 and a molecular weight of 366.28 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;3,4,5-trihydroxybenzoic acid.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 87916459 |
| Molecular Formula | C13H18O12 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;3,4,5-trihydroxybenzoic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C7H6O5.C6H12O7/c8-4-1-3(7(11)12)2-5(9)6(4)10;7-1-2(8)3(9)4(10)5(11)6(12)13/h1-2,8-10H,(H,11,12);2-5,7-11H,1H2,(H,12,13)/t;2-,3-,4+,5-/m.1/s1 |
| InChIKey | OOBNXXLNBOCCIT-IFWQJVLJSA-N |
| XLogP | -2.99 |
| TPSA | 236.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|