C14H23NO8 — CID 174940441
4-(2-aminoethyl)benzene-1,2-diol;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174940441) has the molecular formula C14H23NO8 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174940441 |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | NCCc1ccc(O)c(O)c1.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H11NO2.C6H12O6/c9-4-3-6-1-2-7(10)8(11)5-6;7-1-3(9)5(11)6(12)4(10)2-8/h1-2,5,10-11H,3-4,9H2;1,3-6,8-12H,2H2 |
| InChIKey | IALIPNMEGOVNCP-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 184.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|