C15H25NO8 — CID 20576824
7-[2-(3,4-dihydroxyphenyl)ethylamino]heptane-1,2,3,4,5,6-hexol (PubChem CID 20576824) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is 7-[2-(3,4-dihydroxyphenyl)ethylamino]heptane-1,2,3,4,5,6-hexol.
| Compound Name | 7-[2-(3,4-dihydroxyphenyl)ethylamino]heptane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 20576824 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 7-[2-(3,4-dihydroxyphenyl)ethylamino]heptane-1,2,3,4,5,6-hexol |
| SMILES | OCC(O)C(O)C(O)C(O)C(O)CNCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H25NO8/c17-7-12(21)14(23)15(24)13(22)11(20)6-16-4-3-8-1-2-9(18)10(19)5-8/h1-2,5,11-24H,3-4,6-7H2 |
| InChIKey | NEEFZBMWQHPZMT-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 173.87 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|