C13H19NO8 — CID 118232754
3,4-dihydroxy-N-[(2R,4R)-2,3,4,5,6-pentahydroxyhexyl]benzamide (PubChem CID 118232754) has the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[(2R,4R)-2,3,4,5,6-pentahydroxyhexyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[(2R,4R)-2,3,4,5,6-pentahydroxyhexyl]benzamide |
|---|---|
| PubChem CID | 118232754 |
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3,4-dihydroxy-N-[(2R,4R)-2,3,4,5,6-pentahydroxyhexyl]benzamide |
| SMILES | O=C(NC[C@@H](O)C(O)[C@H](O)C(O)CO)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H19NO8/c15-5-10(19)12(21)11(20)9(18)4-14-13(22)6-1-2-7(16)8(17)3-6/h1-3,9-12,15-21H,4-5H2,(H,14,22)/t9-,10?,11?,12-/m1/s1 |
| InChIKey | WNAFHJAZSZUPIU-HBIQZDMRSA-N |
| XLogP | -2.74 |
| TPSA | 170.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|