C19H23NO6 — CID 175913500
N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-4-phenylbenzamide (PubChem CID 175913500) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-4-phenylbenzamide.
| Compound Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 175913500 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-4-phenylbenzamide |
| SMILES | O=C(NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO6/c21-11-16(23)18(25)17(24)15(22)10-20-19(26)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-18,21-25H,10-11H2,(H,20,26)/t15-,16+,17+,18+/m0/s1 |
| InChIKey | MNLOMUVENMLJNF-BSDSXHPESA-N |
| XLogP | -0.48 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |