C12H27NO6 — CID 146519465
7-(3-methylbutylamino)heptane-1,2,3,4,5,6-hexol (PubChem CID 146519465) has the molecular formula C12H27NO6 and a molecular weight of 281.35 g/mol. Its IUPAC name is 7-(3-methylbutylamino)heptane-1,2,3,4,5,6-hexol.
| Compound Name | 7-(3-methylbutylamino)heptane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 146519465 |
| Molecular Formula | C12H27NO6 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 7-(3-methylbutylamino)heptane-1,2,3,4,5,6-hexol |
| SMILES | CC(C)CCNCC(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H27NO6/c1-7(2)3-4-13-5-8(15)10(17)12(19)11(18)9(16)6-14/h7-19H,3-6H2,1-2H3 |
| InChIKey | HNCWROKXHFXALX-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|