C13H30N2O5 — CID 22797316
(2R,3R,4R,5S)-6-[3-(diethylamino)propylamino]hexane-1,2,3,4,5-pentol (PubChem CID 22797316) has the molecular formula C13H30N2O5 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[3-(diethylamino)propylamino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[3-(diethylamino)propylamino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 22797316 |
| Molecular Formula | C13H30N2O5 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2R,3R,4R,5S)-6-[3-(diethylamino)propylamino]hexane-1,2,3,4,5-pentol |
| SMILES | CCN(CC)CCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H30N2O5/c1-3-15(4-2)7-5-6-14-8-10(17)12(19)13(20)11(18)9-16/h10-14,16-20H,3-9H2,1-2H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | IBCAQYNYAICXGQ-UMSGYPCISA-N |
| XLogP | -2.26 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|