C8H19NO5S — CID 11601181
(2R,3R,4R,5R)-6-(2-sulfanylethylamino)hexane-1,2,3,4,5-pentol (PubChem CID 11601181) has the molecular formula C8H19NO5S and a molecular weight of 241.31 g/mol. Its IUPAC name is (2R,3R,4R,5R)-6-(2-sulfanylethylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5R)-6-(2-sulfanylethylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 11601181 |
| Molecular Formula | C8H19NO5S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2R,3R,4R,5R)-6-(2-sulfanylethylamino)hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CNCCS |
| InChI | InChI=1S/C8H19NO5S/c10-4-6(12)8(14)7(13)5(11)3-9-1-2-15/h5-15H,1-4H2/t5-,6-,7-,8-/m1/s1 |
| InChIKey | VMLQRYLBEXRJIK-WCTZXXKLSA-N |
| XLogP | -3.06 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|