C10H23NO5 — CID 16738764
(2S,3S,4S,5R)-6-(butylamino)hexane-1,2,3,4,5-pentol (PubChem CID 16738764) has the molecular formula C10H23NO5 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-(butylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3S,4S,5R)-6-(butylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 16738764 |
| Molecular Formula | C10H23NO5 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | (2S,3S,4S,5R)-6-(butylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CCCCNC[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H23NO5/c1-2-3-4-11-5-7(13)9(15)10(16)8(14)6-12/h7-16H,2-6H2,1H3/t7-,8+,9+,10+/m1/s1 |
| InChIKey | QVEUDPHFUKJQHH-KATARQTJSA-N |
| XLogP | -2.19 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|