C24H54N2O10 — CID 159342301
(2R,3R,4R,5S)-6-(hexylamino)hexane-1,2,3,4,5-pentol;6-(hexylamino)hexane-1,2,3,4,5-pentol (PubChem CID 159342301) has the molecular formula C24H54N2O10 and a molecular weight of 530.70 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(hexylamino)hexane-1,2,3,4,5-pentol;6-(hexylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-(hexylamino)hexane-1,2,3,4,5-pentol;6-(hexylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 159342301 |
| Molecular Formula | C24H54N2O10 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | (2R,3R,4R,5S)-6-(hexylamino)hexane-1,2,3,4,5-pentol;6-(hexylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCNCC(O)C(O)C(O)C(O)CO.CCCCCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C12H27NO5/c2*1-2-3-4-5-6-13-7-9(15)11(17)12(18)10(16)8-14/h2*9-18H,2-8H2,1H3/t9-,10+,11+,12+;/m0./s1 |
| InChIKey | LGHBPBYSZQWWPJ-YLDWUBEVSA-N |
| XLogP | -2.82 |
| TPSA | 226.36 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|