C18H39NO2 — CID 87604065
2-(hexadecylamino)ethane-1,1-diol (PubChem CID 87604065) has the molecular formula C18H39NO2 and a molecular weight of 301.51 g/mol. Its IUPAC name is 2-(hexadecylamino)ethane-1,1-diol.
| Compound Name | 2-(hexadecylamino)ethane-1,1-diol |
|---|---|
| PubChem CID | 87604065 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | 2-(hexadecylamino)ethane-1,1-diol |
| SMILES | CCCCCCCCCCCCCCCCNCC(O)O |
| InChI | InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17-18(20)21/h18-21H,2-17H2,1H3 |
| InChIKey | FFKSQDWRKALCJY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|