C20H41NO2 — CID 134360654
2-[[(Z)-octadec-9-enyl]amino]ethane-1,1-diol (PubChem CID 134360654) has the molecular formula C20H41NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is 2-[[(Z)-octadec-9-enyl]amino]ethane-1,1-diol.
| Compound Name | 2-[[(Z)-octadec-9-enyl]amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 134360654 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | 2-[[(Z)-octadec-9-enyl]amino]ethane-1,1-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNCC(O)O |
| InChI | InChI=1S/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-20(22)23/h9-10,20-23H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | YTLXTTVKZCUYGL-KTKRTIGZSA-N |
| XLogP | 4.92 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|