C37H78NO7P — CID 88516836
2-[[(Z)-nonadec-10-enyl]amino]ethane-1,1-diol;2-tetradecoxyethyl dihydrogen phosphate (PubChem CID 88516836) has the molecular formula C37H78NO7P and a molecular weight of 680.01 g/mol. Its IUPAC name is 2-[[(Z)-nonadec-10-enyl]amino]ethane-1,1-diol;2-tetradecoxyethyl dihydrogen phosphate.
| Compound Name | 2-[[(Z)-nonadec-10-enyl]amino]ethane-1,1-diol;2-tetradecoxyethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 88516836 |
| Molecular Formula | C37H78NO7P |
| Molecular Weight | 680.01 g/mol |
| Exact Mass | 679.55 |
| IUPAC Name | 2-[[(Z)-nonadec-10-enyl]amino]ethane-1,1-diol;2-tetradecoxyethyl dihydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCNCC(O)O.CCCCCCCCCCCCCCOCCOP(=O)(O)O |
| InChI | InChI=1S/C21H43NO2.C16H35O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-21(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-20-15-16-21-22(17,18)19/h9-10,21-24H,2-8,11-20H2,1H3;2-16H2,1H3,(H2,17,18,19)/b10-9-; |
| InChIKey | QZDHUHKOLCHQKJ-KVVVOXFISA-N |
| XLogP | 10.13 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.01 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|