C21H43NO2 — CID 76749826
3-(octadec-9-enylamino)propane-1,2-diol (PubChem CID 76749826) has the molecular formula C21H43NO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is 3-(octadec-9-enylamino)propane-1,2-diol.
| Compound Name | 3-(octadec-9-enylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 76749826 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | 3-(octadec-9-enylamino)propane-1,2-diol |
| SMILES | CCCCCCCCC=CCCCCCCCCNCC(O)CO |
| InChI | InChI=1S/C21H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19-21(24)20-23/h9-10,21-24H,2-8,11-20H2,1H3 |
| InChIKey | VLPKQAAYUPRAQJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|