C20H45NO3 — CID 173098579
2-(octadecylamino)ethane-1,1-diol;hydrate (PubChem CID 173098579) has the molecular formula C20H45NO3 and a molecular weight of 347.58 g/mol. Its IUPAC name is 2-(octadecylamino)ethane-1,1-diol;hydrate.
| Compound Name | 2-(octadecylamino)ethane-1,1-diol;hydrate |
|---|---|
| PubChem CID | 173098579 |
| Molecular Formula | C20H45NO3 |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.34 |
| IUPAC Name | 2-(octadecylamino)ethane-1,1-diol;hydrate |
| SMILES | CCCCCCCCCCCCCCCCCCNCC(O)O.O |
| InChI | InChI=1S/C20H43NO2.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-20(22)23;/h20-23H,2-19H2,1H3;1H2 |
| InChIKey | BBGCYUIRSZKXSX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|