C19H42BrNO2 — CID 175162321
2-(heptadecylamino)ethane-1,1-diol;hydrobromide (PubChem CID 175162321) has the molecular formula C19H42BrNO2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-(heptadecylamino)ethane-1,1-diol;hydrobromide.
| Compound Name | 2-(heptadecylamino)ethane-1,1-diol;hydrobromide |
|---|---|
| PubChem CID | 175162321 |
| Molecular Formula | C19H42BrNO2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-(heptadecylamino)ethane-1,1-diol;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCCCCNCC(O)O |
| InChI | InChI=1S/C19H41NO2.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18-19(21)22;/h19-22H,2-18H2,1H3;1H |
| InChIKey | OQHNOLDHFDDAPU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|