ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol

C24H53NO6S — CID 175316321

IUPACethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol
SMILESCCCCCCCCCCCCCCCCCCCCNCC(O)O.CCOS(=O)(=O)O
InChIInChI=1S/C22H47NO2.C2H6O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21-22(24)25;1-2-6-7(3,4)5/h22-25H,2-21H2,1H3;2H2,1H3,(H,3,4,5)
InChIKeyPBUHGSZHHHFAKO-UHFFFAOYSA-N
MW483.76 g/mol
LogP5.75
Rot. Bonds23

About ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol

ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol (PubChem CID 175316321) has the molecular formula C24H53NO6S and a molecular weight of 483.76 g/mol. Its IUPAC name is ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol.

Molecular Properties

Compound Nameethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol
PubChem CID175316321
Molecular FormulaC24H53NO6S
Molecular Weight483.76 g/mol
Exact Mass483.36
IUPAC Nameethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol
SMILESCCCCCCCCCCCCCCCCCCCCNCC(O)O.CCOS(=O)(=O)O
InChIInChI=1S/C22H47NO2.C2H6O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21-22(24)25;1-2-6-7(3,4)5/h22-25H,2-21H2,1H3;2H2,1H3,(H,3,4,5)
InChIKeyPBUHGSZHHHFAKO-UHFFFAOYSA-N
XLogP5.75
TPSA116.09 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds23
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500483.76
LogP ≤ 55.75
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol?
The IUPAC name of ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol (CID 175316321) is ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol.
What is the SMILES notation for ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol?
The canonical SMILES for ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol is CCCCCCCCCCCCCCCCCCCCNCC(O)O.CCOS(=O)(=O)O.
What is the InChIKey of ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol?
The InChIKey is PBUHGSZHHHFAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H47NO2.C2H6O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21-22(24)25;1-2-6-7(3,4)5/h22-25H,2-21H2,1H3;2H2,1H3,(H,3,4,5).
What are the key properties of ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol?
ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol has a molecular weight of 483.76 g/mol, XLogP of 5.75, 23 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol is sourced from PubChem (CID 175316321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).