C24H53NO6S — CID 175316321
ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol (PubChem CID 175316321) has the molecular formula C24H53NO6S and a molecular weight of 483.76 g/mol. Its IUPAC name is ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol.
| Compound Name | ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol |
|---|---|
| PubChem CID | 175316321 |
| Molecular Formula | C24H53NO6S |
| Molecular Weight | 483.76 g/mol |
| Exact Mass | 483.36 |
| IUPAC Name | ethyl hydrogen sulfate;2-(icosylamino)ethane-1,1-diol |
| SMILES | CCCCCCCCCCCCCCCCCCCCNCC(O)O.CCOS(=O)(=O)O |
| InChI | InChI=1S/C22H47NO2.C2H6O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21-22(24)25;1-2-6-7(3,4)5/h22-25H,2-21H2,1H3;2H2,1H3,(H,3,4,5) |
| InChIKey | PBUHGSZHHHFAKO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|