C11H23NO6 — CID 87279547
(2R,3R,4R,5S)-6-(3-ethenoxypropylamino)hexane-1,2,3,4,5-pentol (PubChem CID 87279547) has the molecular formula C11H23NO6 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(3-ethenoxypropylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-(3-ethenoxypropylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 87279547 |
| Molecular Formula | C11H23NO6 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (2R,3R,4R,5S)-6-(3-ethenoxypropylamino)hexane-1,2,3,4,5-pentol |
| SMILES | C=COCCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H23NO6/c1-2-18-5-3-4-12-6-8(14)10(16)11(17)9(15)7-13/h2,8-17H,1,3-7H2/t8-,9+,10+,11+/m0/s1 |
| InChIKey | TWZBFXFPVCDMOJ-LNFKQOIKSA-N |
| XLogP | -2.44 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|