C9H21NO6 — CID 21257697
5-[2-(1-hydroxyethoxy)ethylamino]pentane-1,2,3,4-tetrol (PubChem CID 21257697) has the molecular formula C9H21NO6 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-[2-(1-hydroxyethoxy)ethylamino]pentane-1,2,3,4-tetrol.
| Compound Name | 5-[2-(1-hydroxyethoxy)ethylamino]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 21257697 |
| Molecular Formula | C9H21NO6 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 5-[2-(1-hydroxyethoxy)ethylamino]pentane-1,2,3,4-tetrol |
| SMILES | CC(O)OCCNCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C9H21NO6/c1-6(12)16-3-2-10-4-7(13)9(15)8(14)5-11/h6-15H,2-5H2,1H3 |
| InChIKey | VAZQHFYMDNWMHG-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|