C6H15NO4 — CID 59973525
(2R,3S,4R)-5-(methylamino)pentane-1,2,3,4-tetrol (PubChem CID 59973525) has the molecular formula C6H15NO4 and a molecular weight of 165.19 g/mol. Its IUPAC name is (2R,3S,4R)-5-(methylamino)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R)-5-(methylamino)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 59973525 |
| Molecular Formula | C6H15NO4 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2R,3S,4R)-5-(methylamino)pentane-1,2,3,4-tetrol |
| SMILES | CNC[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15NO4/c1-7-2-4(9)6(11)5(10)3-8/h4-11H,2-3H2,1H3/t4-,5-,6+/m1/s1 |
| InChIKey | KYYOVZHUAVNUCN-PBXRRBTRSA-N |
| XLogP | -2.72 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |