C11H28N2O8 — CID 87714012
2-amino-2-(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 87714012) has the molecular formula C11H28N2O8 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 87714012 |
| Molecular Formula | C11H28N2O8 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.NC(CO)(CO)CO |
| InChI | InChI=1S/C7H17NO5.C4H11NO3/c1-8-2-4(10)6(12)7(13)5(11)3-9;5-4(1-6,2-7)3-8/h4-13H,2-3H2,1H3;6-8H,1-3,5H2/t4-,5+,6+,7+;/m0./s1 |
| InChIKey | HNKOUGAWGJCUDW-LJTMIZJLSA-N |
| XLogP | -5.70 |
| TPSA | 199.89 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -5.70 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |