C7H22N2O6 — CID 172742927
azane;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;hydrate (PubChem CID 172742927) has the molecular formula C7H22N2O6 and a molecular weight of 230.26 g/mol. Its IUPAC name is azane;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;hydrate.
| Compound Name | azane;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;hydrate |
|---|---|
| PubChem CID | 172742927 |
| Molecular Formula | C7H22N2O6 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | azane;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;hydrate |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.N.O |
| InChI | InChI=1S/C7H17NO5.H3N.H2O/c1-8-2-4(10)6(12)7(13)5(11)3-9;;/h4-13H,2-3H2,1H3;1H3;1H2/t4-,5+,6+,7+;;/m0../s1 |
| InChIKey | JIKXIOUEGZZYMV-GPKONXIGSA-N |
| XLogP | -4.02 |
| TPSA | 179.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |