C7H19CaNO5 — CID 173199422
calcium;hydride;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 173199422) has the molecular formula C7H19CaNO5 and a molecular weight of 237.31 g/mol. Its IUPAC name is calcium;hydride;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | calcium;hydride;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 173199422 |
| Molecular Formula | C7H19CaNO5 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | calcium;hydride;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C7H17NO5.Ca.2H/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;/h4-13H,2-3H2,1H3;;;/q;+2;2*-1/t4-,5+,6+,7+;;;/m0.../s1 |
| InChIKey | QZKVOEDFPGBYQH-RHLRHBBGSA-N |
| XLogP | -3.51 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |