C7H21N3O5 — CID 161070671
hydrazine;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 161070671) has the molecular formula C7H21N3O5 and a molecular weight of 227.26 g/mol. Its IUPAC name is hydrazine;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | hydrazine;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 161070671 |
| Molecular Formula | C7H21N3O5 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | hydrazine;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.NN |
| InChI | InChI=1S/C7H17NO5.H4N2/c1-8-2-4(10)6(12)7(13)5(11)3-9;1-2/h4-13H,2-3H2,1H3;1-2H2/t4-,5+,6+,7+;/m0./s1 |
| InChIKey | UEPMQFRDUXXNON-LJTMIZJLSA-N |
| XLogP | -4.54 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|