C8H19NO6S2 — CID 158653369
carbonodithioic S,S-acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 158653369) has the molecular formula C8H19NO6S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is carbonodithioic S,S-acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | carbonodithioic S,S-acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 158653369 |
| Molecular Formula | C8H19NO6S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | carbonodithioic S,S-acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(S)S |
| InChI | InChI=1S/C7H17NO5.CH2OS2/c1-8-2-4(10)6(12)7(13)5(11)3-9;2-1(3)4/h4-13H,2-3H2,1H3;(H2,2,3,4)/t4-,5+,6+,7+;/m0./s1 |
| InChIKey | IBVBZQOMNDGPIQ-LJTMIZJLSA-N |
| XLogP | -2.39 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|