C18H36N2O12 — CID 142663246
2,3,4,5,6,11,12,13,14,15-decahydroxy-1,16-bis(methylamino)hexadecane-7,10-dione (PubChem CID 142663246) has the molecular formula C18H36N2O12 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2,3,4,5,6,11,12,13,14,15-decahydroxy-1,16-bis(methylamino)hexadecane-7,10-dione.
| Compound Name | 2,3,4,5,6,11,12,13,14,15-decahydroxy-1,16-bis(methylamino)hexadecane-7,10-dione |
|---|---|
| PubChem CID | 142663246 |
| Molecular Formula | C18H36N2O12 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2,3,4,5,6,11,12,13,14,15-decahydroxy-1,16-bis(methylamino)hexadecane-7,10-dione |
| SMILES | CNCC(O)C(O)C(O)C(O)C(O)C(=O)CCC(=O)C(O)C(O)C(O)C(O)C(O)CNC |
| InChI | InChI=1S/C18H36N2O12/c1-19-5-9(23)13(27)17(31)15(29)11(25)7(21)3-4-8(22)12(26)16(30)18(32)14(28)10(24)6-20-2/h9-20,23-32H,3-6H2,1-2H3 |
| InChIKey | YCLODTJHPMZYIS-UHFFFAOYSA-N |
| XLogP | -7.05 |
| TPSA | 260.50 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | -7.05 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |